C14H19NO3 — CID 58048667
7'a-(2-oxoethyl)spiro[1,3-dioxolane-2,3'-2,3a,4,5,6,7-hexahydro-1H-indene]-4'-carbonitrile (PubChem CID 58048667) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is 7'a-(2-oxoethyl)spiro[1,3-dioxolane-2,3'-2,3a,4,5,6,7-hexahydro-1H-indene]-4'-carbonitrile.
| Compound Name | 7'a-(2-oxoethyl)spiro[1,3-dioxolane-2,3'-2,3a,4,5,6,7-hexahydro-1H-indene]-4'-carbonitrile |
|---|---|
| PubChem CID | 58048667 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | 7'a-(2-oxoethyl)spiro[1,3-dioxolane-2,3'-2,3a,4,5,6,7-hexahydro-1H-indene]-4'-carbonitrile |
| SMILES | N#CC1CCCC2(CC=O)CCC3(OCCO3)C12 |
| InChI | InChI=1S/C14H19NO3/c15-10-11-2-1-3-13(6-7-16)4-5-14(12(11)13)17-8-9-18-14/h7,11-12H,1-6,8-9H2 |
| InChIKey | SZUJTWJVZIKCIR-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|