C19H28O3 — CID 58048682
1-(7'a-prop-2-enylspiro[1,3-dioxolane-2,3'-2,3a,4,5,6,7-hexahydro-1H-indene]-4'-yl)-3-methylbut-3-en-1-one (PubChem CID 58048682) has the molecular formula C19H28O3 and a molecular weight of 304.43 g/mol. Its IUPAC name is 1-(7'a-prop-2-enylspiro[1,3-dioxolane-2,3'-2,3a,4,5,6,7-hexahydro-1H-indene]-4'-yl)-3-methylbut-3-en-1-one.
| Compound Name | 1-(7'a-prop-2-enylspiro[1,3-dioxolane-2,3'-2,3a,4,5,6,7-hexahydro-1H-indene]-4'-yl)-3-methylbut-3-en-1-one |
|---|---|
| PubChem CID | 58048682 |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | 1-(7'a-prop-2-enylspiro[1,3-dioxolane-2,3'-2,3a,4,5,6,7-hexahydro-1H-indene]-4'-yl)-3-methylbut-3-en-1-one |
| SMILES | C=CCC12CCCC(C(=O)CC(=C)C)C1C1(CC2)OCCO1 |
| InChI | InChI=1S/C19H28O3/c1-4-7-18-8-5-6-15(16(20)13-14(2)3)17(18)19(10-9-18)21-11-12-22-19/h4,15,17H,1-2,5-13H2,3H3 |
| InChIKey | ISWKYBZZUWKNBY-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|