C14H20O4 — CID 58048719
7'a-(2-oxoethyl)spiro[1,3-dioxolane-2,3'-2,3a,4,5,6,7-hexahydro-1H-indene]-4'-carbaldehyde (PubChem CID 58048719) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is 7'a-(2-oxoethyl)spiro[1,3-dioxolane-2,3'-2,3a,4,5,6,7-hexahydro-1H-indene]-4'-carbaldehyde.
| Compound Name | 7'a-(2-oxoethyl)spiro[1,3-dioxolane-2,3'-2,3a,4,5,6,7-hexahydro-1H-indene]-4'-carbaldehyde |
|---|---|
| PubChem CID | 58048719 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 7'a-(2-oxoethyl)spiro[1,3-dioxolane-2,3'-2,3a,4,5,6,7-hexahydro-1H-indene]-4'-carbaldehyde |
| SMILES | O=CCC12CCCC(C=O)C1C1(CC2)OCCO1 |
| InChI | InChI=1S/C14H20O4/c15-7-6-13-3-1-2-11(10-16)12(13)14(5-4-13)17-8-9-18-14/h7,10-12H,1-6,8-9H2 |
| InChIKey | FIDYTNHDRMMDKA-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|