C13H22O5 — CID 58049018
(1R)-1-[(3aR,5R,6S,6aR)-5-ethyl-6-methoxy-2,2-dimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]prop-2-en-1-ol (PubChem CID 58049018) has the molecular formula C13H22O5 and a molecular weight of 258.31 g/mol. Its IUPAC name is (1R)-1-[(3aR,5R,6S,6aR)-5-ethyl-6-methoxy-2,2-dimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]prop-2-en-1-ol.
| Compound Name | (1R)-1-[(3aR,5R,6S,6aR)-5-ethyl-6-methoxy-2,2-dimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]prop-2-en-1-ol |
|---|---|
| PubChem CID | 58049018 |
| Molecular Formula | C13H22O5 |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | (1R)-1-[(3aR,5R,6S,6aR)-5-ethyl-6-methoxy-2,2-dimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]prop-2-en-1-ol |
| SMILES | C=C[C@@H](O)[C@@]1(CC)O[C@@H]2OC(C)(C)O[C@@H]2[C@@H]1OC |
| InChI | InChI=1S/C13H22O5/c1-6-8(14)13(7-2)10(15-5)9-11(18-13)17-12(3,4)16-9/h6,8-11,14H,1,7H2,2-5H3/t8-,9-,10+,11+,13-/m1/s1 |
| InChIKey | WEAQQAZLLOAPFJ-CFDXXZMTSA-N |
| XLogP | 1.20 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|