C13H21O4U- — CID 58049048
[(3S,4S,5R)-5-[(2S)-but-3-en-2-yl]-5-ethyl-4-methoxy-3,4-dihydro-2H-furan-2-id-3-yl] acetate;uranium (PubChem CID 58049048) has the molecular formula C13H21O4U- and a molecular weight of 479.34 g/mol. Its IUPAC name is [(3S,4S,5R)-5-[(2S)-but-3-en-2-yl]-5-ethyl-4-methoxy-3,4-dihydro-2H-furan-2-id-3-yl] acetate;uranium.
| Compound Name | [(3S,4S,5R)-5-[(2S)-but-3-en-2-yl]-5-ethyl-4-methoxy-3,4-dihydro-2H-furan-2-id-3-yl] acetate;uranium |
|---|---|
| PubChem CID | 58049048 |
| Molecular Formula | C13H21O4U- |
| Molecular Weight | 479.34 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | [(3S,4S,5R)-5-[(2S)-but-3-en-2-yl]-5-ethyl-4-methoxy-3,4-dihydro-2H-furan-2-id-3-yl] acetate;uranium |
| SMILES | C=C[C@H](C)[C@@]1(CC)O[CH-][C@H](OC(C)=O)[C@@H]1OC.[U] |
| InChI | InChI=1S/C13H21O4.U/c1-6-9(3)13(7-2)12(15-5)11(8-16-13)17-10(4)14;/h6,8-9,11-12H,1,7H2,2-5H3;/q-1;/t9-,11-,12-,13+;/m0./s1 |
| InChIKey | HKSAOXOJMBHZIM-WRXPESLUSA-N |
| XLogP | 2.10 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.34 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|