C17H25NO6S — CID 58049194
4-[7-methoxy-2,2-dimethyl-4-(sulfomethyl)-3,4-dihydroquinolin-1-yl]butanoic acid (PubChem CID 58049194) has the molecular formula C17H25NO6S and a molecular weight of 371.46 g/mol. Its IUPAC name is 4-[7-methoxy-2,2-dimethyl-4-(sulfomethyl)-3,4-dihydroquinolin-1-yl]butanoic acid.
| Compound Name | 4-[7-methoxy-2,2-dimethyl-4-(sulfomethyl)-3,4-dihydroquinolin-1-yl]butanoic acid |
|---|---|
| PubChem CID | 58049194 |
| Molecular Formula | C17H25NO6S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 4-[7-methoxy-2,2-dimethyl-4-(sulfomethyl)-3,4-dihydroquinolin-1-yl]butanoic acid |
| SMILES | COc1ccc2c(c1)N(CCCC(=O)O)C(C)(C)CC2CS(=O)(=O)O |
| InChI | InChI=1S/C17H25NO6S/c1-17(2)10-12(11-25(21,22)23)14-7-6-13(24-3)9-15(14)18(17)8-4-5-16(19)20/h6-7,9,12H,4-5,8,10-11H2,1-3H3,(H,19,20)(H,21,22,23) |
| InChIKey | RGBPXMYIIFZOON-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|