C17H23NO3 — CID 58049364
ethyl 4-(6,7-dimethyl-1,2,3,4-tetrahydroisoquinolin-1-yl)-3-oxobutanoate (PubChem CID 58049364) has the molecular formula C17H23NO3 and a molecular weight of 289.38 g/mol. Its IUPAC name is ethyl 4-(6,7-dimethyl-1,2,3,4-tetrahydroisoquinolin-1-yl)-3-oxobutanoate.
| Compound Name | ethyl 4-(6,7-dimethyl-1,2,3,4-tetrahydroisoquinolin-1-yl)-3-oxobutanoate |
|---|---|
| PubChem CID | 58049364 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | ethyl 4-(6,7-dimethyl-1,2,3,4-tetrahydroisoquinolin-1-yl)-3-oxobutanoate |
| SMILES | CCOC(=O)CC(=O)CC1NCCc2cc(C)c(C)cc21 |
| InChI | InChI=1S/C17H23NO3/c1-4-21-17(20)10-14(19)9-16-15-8-12(3)11(2)7-13(15)5-6-18-16/h7-8,16,18H,4-6,9-10H2,1-3H3 |
| InChIKey | HQSNXZPJFXJFAK-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|