C18H15F9N2O — CID 58049598
2-[2-amino-5-[2-(4-aminophenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-1,1,1-trifluoropropan-2-ol (PubChem CID 58049598) has the molecular formula C18H15F9N2O and a molecular weight of 446.31 g/mol. Its IUPAC name is 2-[2-amino-5-[2-(4-aminophenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-1,1,1-trifluoropropan-2-ol.
| Compound Name | 2-[2-amino-5-[2-(4-aminophenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 58049598 |
| Molecular Formula | C18H15F9N2O |
| Molecular Weight | 446.31 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | 2-[2-amino-5-[2-(4-aminophenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-1,1,1-trifluoropropan-2-ol |
| SMILES | CC(O)(c1cc(C(c2ccc(N)cc2)(C(F)(F)F)C(F)(F)F)ccc1N)C(F)(F)F |
| InChI | InChI=1S/C18H15F9N2O/c1-14(30,16(19,20)21)12-8-10(4-7-13(12)29)15(17(22,23)24,18(25,26)27)9-2-5-11(28)6-3-9/h2-8,30H,28-29H2,1H3 |
| InChIKey | UCKNFXGGLIOCGX-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.31 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|