C70H42N8 — CID 58049687
4-[5-[6-(3-isocyano-2,7,9-triphenyl-1,10-phenanthrolin-4-yl)-3-pyridinyl]-2-pyridinyl]-2,7,9-triphenylpyrido[3,2-h]quinazoline (PubChem CID 58049687) has the molecular formula C70H42N8 and a molecular weight of 995.16 g/mol. Its IUPAC name is 4-[5-[6-(3-isocyano-2,7,9-triphenyl-1,10-phenanthrolin-4-yl)-3-pyridinyl]-2-pyridinyl]-2,7,9-triphenylpyrido[3,2-h]quinazoline.
| Compound Name | 4-[5-[6-(3-isocyano-2,7,9-triphenyl-1,10-phenanthrolin-4-yl)-3-pyridinyl]-2-pyridinyl]-2,7,9-triphenylpyrido[3,2-h]quinazoline |
|---|---|
| PubChem CID | 58049687 |
| Molecular Formula | C70H42N8 |
| Molecular Weight | 995.16 g/mol |
| Exact Mass | 994.35 |
| IUPAC Name | 4-[5-[6-(3-isocyano-2,7,9-triphenyl-1,10-phenanthrolin-4-yl)-3-pyridinyl]-2-pyridinyl]-2,7,9-triphenylpyrido[3,2-h]quinazoline |
| SMILES | [C-]#[N+]c1c(-c2ccccc2)nc2c(ccc3c(-c4ccccc4)cc(-c4ccccc4)nc32)c1-c1ccc(-c2ccc(-c3nc(-c4ccccc4)nc4c3ccc3c(-c5ccccc5)cc(-c5ccccc5)nc34)nc2)cn1 |
| InChI | InChI=1S/C70H42N8/c1-71-69-62(54-36-34-52-56(44-20-8-2-9-21-44)40-60(46-24-12-4-13-25-46)74-65(52)67(54)76-63(69)48-28-16-6-17-29-48)58-38-32-50(42-72-58)51-33-39-59(73-43-51)64-55-37-35-53-57(45-22-10-3-11-23-45)41-61(47-26-14-5-15-27-47)75-66(53)68(55)78-70(77-64)49-30-18-7-19-31-49/h2-43H |
| InChIKey | ASKOQQHZUFOYFT-UHFFFAOYSA-N |
| XLogP | 17.62 |
| TPSA | 94.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 995.16 |
| LogP ≤ 5 | 17.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|