About beryllium bis(5,5-dimethyl-3-naphthalen-1-ylindeno[1,2-b]pyridin-9-olate)
beryllium bis(5,5-dimethyl-3-naphthalen-1-ylindeno[1,2-b]pyridin-9-olate) (PubChem CID 58049963) has the molecular formula C48H36BeN2O2
and a molecular weight of 681.84 g/mol. Its IUPAC name is beryllium bis(5,5-dimethyl-3-naphthalen-1-ylindeno[1,2-b]pyridin-9-olate).
Molecular Properties
| Compound Name | beryllium bis(5,5-dimethyl-3-naphthalen-1-ylindeno[1,2-b]pyridin-9-olate) |
| PubChem CID | 58049963 |
| Molecular Formula | C48H36BeN2O2 |
| Molecular Weight | 681.84 g/mol |
| Exact Mass | 681.29 |
| IUPAC Name | beryllium bis(5,5-dimethyl-3-naphthalen-1-ylindeno[1,2-b]pyridin-9-olate) |
| SMILES | CC1(C)c2cc(-c3cccc4ccccc34)cnc2-c2c([O-])cccc21.CC1(C)c2cc(-c3cccc4ccccc34)cnc2-c2c([O-])cccc21.[Be+2] |
| InChI | InChI=1S/2C24H19NO.Be/c2*1-24(2)19-11-6-12-21(26)22(19)23-20(24)13-16(14-25-23)18-10-5-8-15-7-3-4-9-17(15)18;/h2*3-14,26H,1-2H3;/q;;+2/p-2 |
| InChIKey | BUAGTSJZNFARKK-UHFFFAOYSA-L |
| XLogP | 10.18 |
| TPSA | 71.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 53 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 681.84 |
| LogP ≤ 5 | 10.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze beryllium bis(5,5-dimethyl-3-naphthalen-1-ylindeno[1,2-b]pyridin-9-olate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of beryllium bis(5,5-dimethyl-3-naphthalen-1-ylindeno[1,2-b]pyridin-9-olate)?
The IUPAC name of beryllium bis(5,5-dimethyl-3-naphthalen-1-ylindeno[1,2-b]pyridin-9-olate) (CID 58049963) is beryllium bis(5,5-dimethyl-3-naphthalen-1-ylindeno[1,2-b]pyridin-9-olate).
What is the SMILES notation for beryllium bis(5,5-dimethyl-3-naphthalen-1-ylindeno[1,2-b]pyridin-9-olate)?
The canonical SMILES for beryllium bis(5,5-dimethyl-3-naphthalen-1-ylindeno[1,2-b]pyridin-9-olate) is CC1(C)c2cc(-c3cccc4ccccc34)cnc2-c2c([O-])cccc21.CC1(C)c2cc(-c3cccc4ccccc34)cnc2-c2c([O-])cccc21.[Be+2].
What is the InChIKey of beryllium bis(5,5-dimethyl-3-naphthalen-1-ylindeno[1,2-b]pyridin-9-olate)?
The InChIKey is BUAGTSJZNFARKK-UHFFFAOYSA-L. The full InChI is InChI=1S/2C24H19NO.Be/c2*1-24(2)19-11-6-12-21(26)22(19)23-20(24)13-16(14-25-23)18-10-5-8-15-7-3-4-9-17(15)18;/h2*3-14,26H,1-2H3;/q;;+2/p-2.
What are the key properties of beryllium bis(5,5-dimethyl-3-naphthalen-1-ylindeno[1,2-b]pyridin-9-olate)?
beryllium bis(5,5-dimethyl-3-naphthalen-1-ylindeno[1,2-b]pyridin-9-olate) has a molecular weight of 681.84 g/mol, XLogP of 10.18, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for beryllium bis(5,5-dimethyl-3-naphthalen-1-ylindeno[1,2-b]pyridin-9-olate) is sourced from PubChem (CID 58049963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).