C26H19BeNO+2 — CID 58050066
beryllium 25,25-dimethyl-13-azoniahexacyclo[12.11.0.02,11.04,9.015,24.018,23]pentacosa-1(14),2,4,6,8,10,12,15(24),16,18,20,22-dodecaen-16-olate (PubChem CID 58050066) has the molecular formula C26H19BeNO+2 and a molecular weight of 370.46 g/mol. Its IUPAC name is beryllium 25,25-dimethyl-13-azoniahexacyclo[12.11.0.02,11.04,9.015,24.018,23]pentacosa-1(14),2,4,6,8,10,12,15(24),16,18,20,22-dodecaen-16-olate.
| Compound Name | beryllium 25,25-dimethyl-13-azoniahexacyclo[12.11.0.02,11.04,9.015,24.018,23]pentacosa-1(14),2,4,6,8,10,12,15(24),16,18,20,22-dodecaen-16-olate |
|---|---|
| PubChem CID | 58050066 |
| Molecular Formula | C26H19BeNO+2 |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | beryllium 25,25-dimethyl-13-azoniahexacyclo[12.11.0.02,11.04,9.015,24.018,23]pentacosa-1(14),2,4,6,8,10,12,15(24),16,18,20,22-dodecaen-16-olate |
| SMILES | CC1(C)c2c([nH+]cc3cc4ccccc4cc23)-c2c([O-])cc3ccccc3c21.[Be+2] |
| InChI | InChI=1S/C26H19NO.Be/c1-26(2)23-19-10-6-5-9-17(19)13-21(28)22(23)25-24(26)20-12-16-8-4-3-7-15(16)11-18(20)14-27-25;/h3-14,28H,1-2H3;/q;+2 |
| InChIKey | BRPPHSOODKSJFL-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 37.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|