About beryllium bis(11,11-dimethylindeno[1,2-c]isoquinolin-7-olate)
beryllium bis(11,11-dimethylindeno[1,2-c]isoquinolin-7-olate) (PubChem CID 58050086) has the molecular formula C36H28BeN2O2
and a molecular weight of 529.64 g/mol. Its IUPAC name is beryllium bis(11,11-dimethylindeno[1,2-c]isoquinolin-7-olate).
Molecular Properties
| Compound Name | beryllium bis(11,11-dimethylindeno[1,2-c]isoquinolin-7-olate) |
| PubChem CID | 58050086 |
| Molecular Formula | C36H28BeN2O2 |
| Molecular Weight | 529.64 g/mol |
| Exact Mass | 529.23 |
| IUPAC Name | beryllium bis(11,11-dimethylindeno[1,2-c]isoquinolin-7-olate) |
| SMILES | CC1(C)c2cccc([O-])c2-c2ncc3ccccc3c21.CC1(C)c2cccc([O-])c2-c2ncc3ccccc3c21.[Be+2] |
| InChI | InChI=1S/2C18H15NO.Be/c2*1-18(2)13-8-5-9-14(20)15(13)17-16(18)12-7-4-3-6-11(12)10-19-17;/h2*3-10,20H,1-2H3;/q;;+2/p-2 |
| InChIKey | JAHIQPYOYBREFE-UHFFFAOYSA-L |
| XLogP | 6.85 |
| TPSA | 71.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 529.64 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze beryllium bis(11,11-dimethylindeno[1,2-c]isoquinolin-7-olate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of beryllium bis(11,11-dimethylindeno[1,2-c]isoquinolin-7-olate)?
The IUPAC name of beryllium bis(11,11-dimethylindeno[1,2-c]isoquinolin-7-olate) (CID 58050086) is beryllium bis(11,11-dimethylindeno[1,2-c]isoquinolin-7-olate).
What is the SMILES notation for beryllium bis(11,11-dimethylindeno[1,2-c]isoquinolin-7-olate)?
The canonical SMILES for beryllium bis(11,11-dimethylindeno[1,2-c]isoquinolin-7-olate) is CC1(C)c2cccc([O-])c2-c2ncc3ccccc3c21.CC1(C)c2cccc([O-])c2-c2ncc3ccccc3c21.[Be+2].
What is the InChIKey of beryllium bis(11,11-dimethylindeno[1,2-c]isoquinolin-7-olate)?
The InChIKey is JAHIQPYOYBREFE-UHFFFAOYSA-L. The full InChI is InChI=1S/2C18H15NO.Be/c2*1-18(2)13-8-5-9-14(20)15(13)17-16(18)12-7-4-3-6-11(12)10-19-17;/h2*3-10,20H,1-2H3;/q;;+2/p-2.
What are the key properties of beryllium bis(11,11-dimethylindeno[1,2-c]isoquinolin-7-olate)?
beryllium bis(11,11-dimethylindeno[1,2-c]isoquinolin-7-olate) has a molecular weight of 529.64 g/mol, XLogP of 6.85, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for beryllium bis(11,11-dimethylindeno[1,2-c]isoquinolin-7-olate) is sourced from PubChem (CID 58050086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).