C21H41O2P — CID 58051226
8-tert-butyl-7,7,9,9-tetraethyl-6,10-dimethyl-1,4-dioxa-8-phosphaspiro[4.5]decane (PubChem CID 58051226) has the molecular formula C21H41O2P and a molecular weight of 356.53 g/mol. Its IUPAC name is 8-tert-butyl-7,7,9,9-tetraethyl-6,10-dimethyl-1,4-dioxa-8-phosphaspiro[4.5]decane.
| Compound Name | 8-tert-butyl-7,7,9,9-tetraethyl-6,10-dimethyl-1,4-dioxa-8-phosphaspiro[4.5]decane |
|---|---|
| PubChem CID | 58051226 |
| Molecular Formula | C21H41O2P |
| Molecular Weight | 356.53 g/mol |
| Exact Mass | 356.28 |
| IUPAC Name | 8-tert-butyl-7,7,9,9-tetraethyl-6,10-dimethyl-1,4-dioxa-8-phosphaspiro[4.5]decane |
| SMILES | CCC1(CC)C(C)C2(OCCO2)C(C)C(CC)(CC)P1C(C)(C)C |
| InChI | InChI=1S/C21H41O2P/c1-10-19(11-2)16(5)21(22-14-15-23-21)17(6)20(12-3,13-4)24(19)18(7,8)9/h16-17H,10-15H2,1-9H3 |
| InChIKey | VVQAZAXMQAAPTK-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.53 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|