C18H35O2P — CID 58051229
9-tert-butyl-3,3,8,8,10,10-hexamethyl-1,5-dioxa-9-phosphaspiro[5.5]undecane (PubChem CID 58051229) has the molecular formula C18H35O2P and a molecular weight of 314.45 g/mol. Its IUPAC name is 9-tert-butyl-3,3,8,8,10,10-hexamethyl-1,5-dioxa-9-phosphaspiro[5.5]undecane.
| Compound Name | 9-tert-butyl-3,3,8,8,10,10-hexamethyl-1,5-dioxa-9-phosphaspiro[5.5]undecane |
|---|---|
| PubChem CID | 58051229 |
| Molecular Formula | C18H35O2P |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.24 |
| IUPAC Name | 9-tert-butyl-3,3,8,8,10,10-hexamethyl-1,5-dioxa-9-phosphaspiro[5.5]undecane |
| SMILES | CC1(C)COC2(CC(C)(C)P(C(C)(C)C)C(C)(C)C2)OC1 |
| InChI | InChI=1S/C18H35O2P/c1-14(2,3)21-16(6,7)10-18(11-17(21,8)9)19-12-15(4,5)13-20-18/h10-13H2,1-9H3 |
| InChIKey | BCBFGHYBLOCDTK-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|