C16H29O2P — CID 58051253
9'-tert-butyl-1',5'-dimethylspiro[1,3-dioxolane-2,3'-9-phosphabicyclo[3.3.1]nonane] (PubChem CID 58051253) has the molecular formula C16H29O2P and a molecular weight of 284.38 g/mol. Its IUPAC name is 9'-tert-butyl-1',5'-dimethylspiro[1,3-dioxolane-2,3'-9-phosphabicyclo[3.3.1]nonane].
| Compound Name | 9'-tert-butyl-1',5'-dimethylspiro[1,3-dioxolane-2,3'-9-phosphabicyclo[3.3.1]nonane] |
|---|---|
| PubChem CID | 58051253 |
| Molecular Formula | C16H29O2P |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | 9'-tert-butyl-1',5'-dimethylspiro[1,3-dioxolane-2,3'-9-phosphabicyclo[3.3.1]nonane] |
| SMILES | CC(C)(C)P1C2(C)CCCC1(C)CC1(C2)OCCO1 |
| InChI | InChI=1S/C16H29O2P/c1-13(2,3)19-14(4)7-6-8-15(19,5)12-16(11-14)17-9-10-18-16/h6-12H2,1-5H3 |
| InChIKey | HPCSHZOIVWZOHS-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|