C19H40O6 — CID 58051576
1,2-bis(3,4-dimethoxybutoxy)-4,4-dimethylpentane (PubChem CID 58051576) has the molecular formula C19H40O6 and a molecular weight of 364.52 g/mol. Its IUPAC name is 1,2-bis(3,4-dimethoxybutoxy)-4,4-dimethylpentane.
| Compound Name | 1,2-bis(3,4-dimethoxybutoxy)-4,4-dimethylpentane |
|---|---|
| PubChem CID | 58051576 |
| Molecular Formula | C19H40O6 |
| Molecular Weight | 364.52 g/mol |
| Exact Mass | 364.28 |
| IUPAC Name | 1,2-bis(3,4-dimethoxybutoxy)-4,4-dimethylpentane |
| SMILES | COCC(CCOCC(CC(C)(C)C)OCCC(COC)OC)OC |
| InChI | InChI=1S/C19H40O6/c1-19(2,3)12-18(25-11-9-17(23-7)14-21-5)15-24-10-8-16(22-6)13-20-4/h16-18H,8-15H2,1-7H3 |
| InChIKey | RNRGPEUNJICTFG-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.52 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|