About (2-oxooxolan-3-yl) 2-methyl-2-(1,1,1-trifluoropropan-2-yloxymethyl)butanoate
(2-oxooxolan-3-yl) 2-methyl-2-(1,1,1-trifluoropropan-2-yloxymethyl)butanoate (PubChem CID 58051831) has the molecular formula C13H19F3O5
and a molecular weight of 312.28 g/mol. Its IUPAC name is (2-oxooxolan-3-yl) 2-methyl-2-(1,1,1-trifluoropropan-2-yloxymethyl)butanoate.
Molecular Properties
| Compound Name | (2-oxooxolan-3-yl) 2-methyl-2-(1,1,1-trifluoropropan-2-yloxymethyl)butanoate |
| PubChem CID | 58051831 |
| Molecular Formula | C13H19F3O5 |
| Molecular Weight | 312.28 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | (2-oxooxolan-3-yl) 2-methyl-2-(1,1,1-trifluoropropan-2-yloxymethyl)butanoate |
| SMILES | CCC(C)(COC(C)C(F)(F)F)C(=O)OC1CCOC1=O |
| InChI | InChI=1S/C13H19F3O5/c1-4-12(3,7-20-8(2)13(14,15)16)11(18)21-9-5-6-19-10(9)17/h8-9H,4-7H2,1-3H3 |
| InChIKey | HBUQOZWNKWUEPS-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.28 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2-oxooxolan-3-yl) 2-methyl-2-(1,1,1-trifluoropropan-2-yloxymethyl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxooxolan-3-yl) 2-methyl-2-(1,1,1-trifluoropropan-2-yloxymethyl)butanoate?
The IUPAC name of (2-oxooxolan-3-yl) 2-methyl-2-(1,1,1-trifluoropropan-2-yloxymethyl)butanoate (CID 58051831) is (2-oxooxolan-3-yl) 2-methyl-2-(1,1,1-trifluoropropan-2-yloxymethyl)butanoate.
What is the SMILES notation for (2-oxooxolan-3-yl) 2-methyl-2-(1,1,1-trifluoropropan-2-yloxymethyl)butanoate?
The canonical SMILES for (2-oxooxolan-3-yl) 2-methyl-2-(1,1,1-trifluoropropan-2-yloxymethyl)butanoate is CCC(C)(COC(C)C(F)(F)F)C(=O)OC1CCOC1=O.
What is the InChIKey of (2-oxooxolan-3-yl) 2-methyl-2-(1,1,1-trifluoropropan-2-yloxymethyl)butanoate?
The InChIKey is HBUQOZWNKWUEPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19F3O5/c1-4-12(3,7-20-8(2)13(14,15)16)11(18)21-9-5-6-19-10(9)17/h8-9H,4-7H2,1-3H3.
What are the key properties of (2-oxooxolan-3-yl) 2-methyl-2-(1,1,1-trifluoropropan-2-yloxymethyl)butanoate?
(2-oxooxolan-3-yl) 2-methyl-2-(1,1,1-trifluoropropan-2-yloxymethyl)butanoate has a molecular weight of 312.28 g/mol, XLogP of 2.23, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxooxolan-3-yl) 2-methyl-2-(1,1,1-trifluoropropan-2-yloxymethyl)butanoate is sourced from PubChem (CID 58051831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).