About 2-fluoroethoxymethyl methyl carbonate
2-fluoroethoxymethyl methyl carbonate (PubChem CID 58051865) has the molecular formula C5H9FO4
and a molecular weight of 152.12 g/mol. Its IUPAC name is 2-fluoroethoxymethyl methyl carbonate.
Molecular Properties
| Compound Name | 2-fluoroethoxymethyl methyl carbonate |
| PubChem CID | 58051865 |
| Molecular Formula | C5H9FO4 |
| Molecular Weight | 152.12 g/mol |
| Exact Mass | 152.05 |
| IUPAC Name | 2-fluoroethoxymethyl methyl carbonate |
| SMILES | COC(=O)OCOCCF |
| InChI | InChI=1S/C5H9FO4/c1-8-5(7)10-4-9-3-2-6/h2-4H2,1H3 |
| InChIKey | OXCKCFVYVNLIHL-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.12 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoroethoxymethyl methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoroethoxymethyl methyl carbonate?
The IUPAC name of 2-fluoroethoxymethyl methyl carbonate (CID 58051865) is 2-fluoroethoxymethyl methyl carbonate.
What is the SMILES notation for 2-fluoroethoxymethyl methyl carbonate?
The canonical SMILES for 2-fluoroethoxymethyl methyl carbonate is COC(=O)OCOCCF.
What is the InChIKey of 2-fluoroethoxymethyl methyl carbonate?
The InChIKey is OXCKCFVYVNLIHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9FO4/c1-8-5(7)10-4-9-3-2-6/h2-4H2,1H3.
What are the key properties of 2-fluoroethoxymethyl methyl carbonate?
2-fluoroethoxymethyl methyl carbonate has a molecular weight of 152.12 g/mol, XLogP of 0.71, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoroethoxymethyl methyl carbonate is sourced from PubChem (CID 58051865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).