C21H24F6O9 — CID 58051904
1,1,1,3,3,3-hexafluoropropan-2-yl 9-(2-methylbutanoyloxy)-10-oxospiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,4'-cyclohexane]-1'-carboxylate (PubChem CID 58051904) has the molecular formula C21H24F6O9 and a molecular weight of 534.40 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 9-(2-methylbutanoyloxy)-10-oxospiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,4'-cyclohexane]-1'-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 9-(2-methylbutanoyloxy)-10-oxospiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,4'-cyclohexane]-1'-carboxylate |
|---|---|
| PubChem CID | 58051904 |
| Molecular Formula | C21H24F6O9 |
| Molecular Weight | 534.40 g/mol |
| Exact Mass | 534.13 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 9-(2-methylbutanoyloxy)-10-oxospiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,4'-cyclohexane]-1'-carboxylate |
| SMILES | CCC(C)C(=O)OC1C(=O)OC2C3OC4(CCC(C(=O)OC(C(F)(F)F)C(F)(F)F)CC4)OC3OC12 |
| InChI | InChI=1S/C21H24F6O9/c1-3-8(2)14(28)32-12-10-11(31-16(12)30)13-17(33-10)36-19(35-13)6-4-9(5-7-19)15(29)34-18(20(22,23)24)21(25,26)27/h8-13,17-18H,3-7H2,1-2H3 |
| InChIKey | CGBLGDDMTIOCGB-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.40 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|