C25H32F6O10 — CID 58051913
[4-[[4-[2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-oxoethyl]-4-methyl-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-yl]oxy]cyclohexyl] 2,2-dimethylbutanoate (PubChem CID 58051913) has the molecular formula C25H32F6O10 and a molecular weight of 606.51 g/mol. Its IUPAC name is [4-[[4-[2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-oxoethyl]-4-methyl-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-yl]oxy]cyclohexyl] 2,2-dimethylbutanoate.
| Compound Name | [4-[[4-[2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-oxoethyl]-4-methyl-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-yl]oxy]cyclohexyl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 58051913 |
| Molecular Formula | C25H32F6O10 |
| Molecular Weight | 606.51 g/mol |
| Exact Mass | 606.19 |
| IUPAC Name | [4-[[4-[2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-oxoethyl]-4-methyl-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-yl]oxy]cyclohexyl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC1CCC(OC2C(=O)OC3C4OC(C)(CC(=O)OC(C(F)(F)F)C(F)(F)F)OC4OC23)CC1 |
| InChI | InChI=1S/C25H32F6O10/c1-5-22(2,3)21(34)36-12-8-6-11(7-9-12)35-16-14-15(38-18(16)33)17-19(39-14)41-23(4,40-17)10-13(32)37-20(24(26,27)28)25(29,30)31/h11-12,14-17,19-20H,5-10H2,1-4H3 |
| InChIKey | RGWBUAUFOXAHEG-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 115.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.51 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|