C14H18F8N3O8S3- — CID 58051963
(1,1-difluoro-2-morpholin-4-yl-2-oxoethyl)sulfonyl-(1,1,2,2,3,3-hexafluoro-3-piperidin-1-ylsulfonylpropyl)sulfonylazanide (PubChem CID 58051963) has the molecular formula C14H18F8N3O8S3- and a molecular weight of 604.50 g/mol. Its IUPAC name is (1,1-difluoro-2-morpholin-4-yl-2-oxoethyl)sulfonyl-(1,1,2,2,3,3-hexafluoro-3-piperidin-1-ylsulfonylpropyl)sulfonylazanide.
| Compound Name | (1,1-difluoro-2-morpholin-4-yl-2-oxoethyl)sulfonyl-(1,1,2,2,3,3-hexafluoro-3-piperidin-1-ylsulfonylpropyl)sulfonylazanide |
|---|---|
| PubChem CID | 58051963 |
| Molecular Formula | C14H18F8N3O8S3- |
| Molecular Weight | 604.50 g/mol |
| Exact Mass | 604.01 |
| IUPAC Name | (1,1-difluoro-2-morpholin-4-yl-2-oxoethyl)sulfonyl-(1,1,2,2,3,3-hexafluoro-3-piperidin-1-ylsulfonylpropyl)sulfonylazanide |
| SMILES | O=C(N1CCOCC1)C(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C14H18F8N3O8S3/c15-11(16,10(26)24-6-8-33-9-7-24)34(27,28)23-35(29,30)13(19,20)12(17,18)14(21,22)36(31,32)25-4-2-1-3-5-25/h1-9H2/q-1 |
| InChIKey | IFNISLCKURCKRC-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 149.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.50 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|