C14H19F8N3O8S3 — CID 58051964
N-(1,1-difluoro-2-morpholin-4-yl-2-oxoethyl)sulfonyl-1,1,2,2,3,3-hexafluoro-3-piperidin-1-ylsulfonylpropane-1-sulfonamide (PubChem CID 58051964) has the molecular formula C14H19F8N3O8S3 and a molecular weight of 605.50 g/mol. Its IUPAC name is N-(1,1-difluoro-2-morpholin-4-yl-2-oxoethyl)sulfonyl-1,1,2,2,3,3-hexafluoro-3-piperidin-1-ylsulfonylpropane-1-sulfonamide.
| Compound Name | N-(1,1-difluoro-2-morpholin-4-yl-2-oxoethyl)sulfonyl-1,1,2,2,3,3-hexafluoro-3-piperidin-1-ylsulfonylpropane-1-sulfonamide |
|---|---|
| PubChem CID | 58051964 |
| Molecular Formula | C14H19F8N3O8S3 |
| Molecular Weight | 605.50 g/mol |
| Exact Mass | 605.02 |
| IUPAC Name | N-(1,1-difluoro-2-morpholin-4-yl-2-oxoethyl)sulfonyl-1,1,2,2,3,3-hexafluoro-3-piperidin-1-ylsulfonylpropane-1-sulfonamide |
| SMILES | O=C(N1CCOCC1)C(F)(F)S(=O)(=O)NS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C14H19F8N3O8S3/c15-11(16,10(26)24-6-8-33-9-7-24)34(27,28)23-35(29,30)13(19,20)12(17,18)14(21,22)36(31,32)25-4-2-1-3-5-25/h23H,1-9H2 |
| InChIKey | QRBLBEZRJLQDAW-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 147.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.50 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|