C27H34F6O5S2 — CID 58051965
2-(1-adamantyl)propan-2-yl 3-[4-(1,1,2,2,3,3-hexafluoropentylsulfonyloxy)phenyl]sulfanylpropanoate (PubChem CID 58051965) has the molecular formula C27H34F6O5S2 and a molecular weight of 616.69 g/mol. Its IUPAC name is 2-(1-adamantyl)propan-2-yl 3-[4-(1,1,2,2,3,3-hexafluoropentylsulfonyloxy)phenyl]sulfanylpropanoate.
| Compound Name | 2-(1-adamantyl)propan-2-yl 3-[4-(1,1,2,2,3,3-hexafluoropentylsulfonyloxy)phenyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 58051965 |
| Molecular Formula | C27H34F6O5S2 |
| Molecular Weight | 616.69 g/mol |
| Exact Mass | 616.18 |
| IUPAC Name | 2-(1-adamantyl)propan-2-yl 3-[4-(1,1,2,2,3,3-hexafluoropentylsulfonyloxy)phenyl]sulfanylpropanoate |
| SMILES | CCC(F)(F)C(F)(F)C(F)(F)S(=O)(=O)Oc1ccc(SCCC(=O)OC(C)(C)C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C27H34F6O5S2/c1-4-25(28,29)26(30,31)27(32,33)40(35,36)38-20-5-7-21(8-6-20)39-10-9-22(34)37-23(2,3)24-14-17-11-18(15-24)13-19(12-17)16-24/h5-8,17-19H,4,9-16H2,1-3H3 |
| InChIKey | GIGDLUCJFDYFIG-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.69 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|