About 6-(aminomethyl)-3,4-dimethylcyclohex-3-ene-1-sulfonic acid
6-(aminomethyl)-3,4-dimethylcyclohex-3-ene-1-sulfonic acid (PubChem CID 58053048) has the molecular formula C9H17NO3S
and a molecular weight of 219.31 g/mol. Its IUPAC name is 6-(aminomethyl)-3,4-dimethylcyclohex-3-ene-1-sulfonic acid.
Molecular Properties
| Compound Name | 6-(aminomethyl)-3,4-dimethylcyclohex-3-ene-1-sulfonic acid |
| PubChem CID | 58053048 |
| Molecular Formula | C9H17NO3S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 6-(aminomethyl)-3,4-dimethylcyclohex-3-ene-1-sulfonic acid |
| SMILES | CC1=C(C)CC(S(=O)(=O)O)C(CN)C1 |
| InChI | InChI=1S/C9H17NO3S/c1-6-3-8(5-10)9(4-7(6)2)14(11,12)13/h8-9H,3-5,10H2,1-2H3,(H,11,12,13) |
| InChIKey | HLZOPAHDRXODGX-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 6-(aminomethyl)-3,4-dimethylcyclohex-3-ene-1-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(aminomethyl)-3,4-dimethylcyclohex-3-ene-1-sulfonic acid?
The IUPAC name of 6-(aminomethyl)-3,4-dimethylcyclohex-3-ene-1-sulfonic acid (CID 58053048) is 6-(aminomethyl)-3,4-dimethylcyclohex-3-ene-1-sulfonic acid.
What is the SMILES notation for 6-(aminomethyl)-3,4-dimethylcyclohex-3-ene-1-sulfonic acid?
The canonical SMILES for 6-(aminomethyl)-3,4-dimethylcyclohex-3-ene-1-sulfonic acid is CC1=C(C)CC(S(=O)(=O)O)C(CN)C1.
What is the InChIKey of 6-(aminomethyl)-3,4-dimethylcyclohex-3-ene-1-sulfonic acid?
The InChIKey is HLZOPAHDRXODGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO3S/c1-6-3-8(5-10)9(4-7(6)2)14(11,12)13/h8-9H,3-5,10H2,1-2H3,(H,11,12,13).
What are the key properties of 6-(aminomethyl)-3,4-dimethylcyclohex-3-ene-1-sulfonic acid?
6-(aminomethyl)-3,4-dimethylcyclohex-3-ene-1-sulfonic acid has a molecular weight of 219.31 g/mol, XLogP of 0.95, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(aminomethyl)-3,4-dimethylcyclohex-3-ene-1-sulfonic acid is sourced from PubChem (CID 58053048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).