C10H6ClF5O2 — CID 580534
(4-chlorophenyl)methyl 2,2,3,3,3-pentafluoropropanoate (PubChem CID 580534) has the molecular formula C10H6ClF5O2 and a molecular weight of 288.60 g/mol. Its IUPAC name is (4-chlorophenyl)methyl 2,2,3,3,3-pentafluoropropanoate.
| Compound Name | (4-chlorophenyl)methyl 2,2,3,3,3-pentafluoropropanoate |
|---|---|
| PubChem CID | 580534 |
| Molecular Formula | C10H6ClF5O2 |
| Molecular Weight | 288.60 g/mol |
| Exact Mass | 288.00 |
| IUPAC Name | (4-chlorophenyl)methyl 2,2,3,3,3-pentafluoropropanoate |
| SMILES | O=C(OCc1ccc(Cl)cc1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H6ClF5O2/c11-7-3-1-6(2-4-7)5-18-8(17)9(12,13)10(14,15)16/h1-4H,5H2 |
| InChIKey | YNOUQZHJUWTECY-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.60 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|