C22H18N4O6 — CID 58053519
(5S)-5-(4-acetylfuro[3,2-c]pyridin-2-yl)-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione (PubChem CID 58053519) has the molecular formula C22H18N4O6 and a molecular weight of 434.41 g/mol. Its IUPAC name is (5S)-5-(4-acetylfuro[3,2-c]pyridin-2-yl)-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-(4-acetylfuro[3,2-c]pyridin-2-yl)-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 58053519 |
| Molecular Formula | C22H18N4O6 |
| Molecular Weight | 434.41 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | (5S)-5-(4-acetylfuro[3,2-c]pyridin-2-yl)-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione |
| SMILES | COc1ccc2c(c1)C(=O)N(C[C@@]1(c3cc4c(C(C)=O)nccc4o3)NC(=O)NC1=O)C2 |
| InChI | InChI=1S/C22H18N4O6/c1-11(27)18-15-8-17(32-16(15)5-6-23-18)22(20(29)24-21(30)25-22)10-26-9-12-3-4-13(31-2)7-14(12)19(26)28/h3-8H,9-10H2,1-2H3,(H2,24,25,29,30)/t22-/m0/s1 |
| InChIKey | NJTSXVFJOWNGGE-QFIPXVFZSA-N |
| XLogP | 1.73 |
| TPSA | 130.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.41 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|