C21H16FN3O5 — CID 58053634
(3R)-3-[(4-fluoro-5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-3-furo[2,3-c]pyridin-2-ylpyrrolidine-2,5-dione (PubChem CID 58053634) has the molecular formula C21H16FN3O5 and a molecular weight of 409.37 g/mol. Its IUPAC name is (3R)-3-[(4-fluoro-5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-3-furo[2,3-c]pyridin-2-ylpyrrolidine-2,5-dione.
| Compound Name | (3R)-3-[(4-fluoro-5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-3-furo[2,3-c]pyridin-2-ylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 58053634 |
| Molecular Formula | C21H16FN3O5 |
| Molecular Weight | 409.37 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | (3R)-3-[(4-fluoro-5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-3-furo[2,3-c]pyridin-2-ylpyrrolidine-2,5-dione |
| SMILES | COc1ccc2c(c1F)C(=O)N(C[C@@]1(c3cc4ccncc4o3)CC(=O)NC1=O)C2 |
| InChI | InChI=1S/C21H16FN3O5/c1-29-13-3-2-12-9-25(19(27)17(12)18(13)22)10-21(7-16(26)24-20(21)28)15-6-11-4-5-23-8-14(11)30-15/h2-6,8H,7,9-10H2,1H3,(H,24,26,28)/t21-/m1/s1 |
| InChIKey | PVWOFMABLYOCCZ-OAQYLSRUSA-N |
| XLogP | 1.92 |
| TPSA | 101.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.37 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|