C22H27F2N3O2 — CID 58054181
(2S)-2-[2-[3-(3,4-difluorophenyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-1-yl]-2-oxoethyl]-N,3,3-trimethylbutanamide (PubChem CID 58054181) has the molecular formula C22H27F2N3O2 and a molecular weight of 403.47 g/mol. Its IUPAC name is (2S)-2-[2-[3-(3,4-difluorophenyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-1-yl]-2-oxoethyl]-N,3,3-trimethylbutanamide.
| Compound Name | (2S)-2-[2-[3-(3,4-difluorophenyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-1-yl]-2-oxoethyl]-N,3,3-trimethylbutanamide |
|---|---|
| PubChem CID | 58054181 |
| Molecular Formula | C22H27F2N3O2 |
| Molecular Weight | 403.47 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | (2S)-2-[2-[3-(3,4-difluorophenyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-1-yl]-2-oxoethyl]-N,3,3-trimethylbutanamide |
| SMILES | CNC(=O)[C@@H](CC(=O)c1nc(-c2ccc(F)c(F)c2)n2c1CCCC2)C(C)(C)C |
| InChI | InChI=1S/C22H27F2N3O2/c1-22(2,3)14(21(29)25-4)12-18(28)19-17-7-5-6-10-27(17)20(26-19)13-8-9-15(23)16(24)11-13/h8-9,11,14H,5-7,10,12H2,1-4H3,(H,25,29)/t14-/m1/s1 |
| InChIKey | GMGGKSWYUHTAPH-CQSZACIVSA-N |
| XLogP | 4.15 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.47 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |