C27H38N4O4 — CID 58054191
tert-butyl 1-[(3S)-4,4-dimethyl-3-(methylcarbamoyl)pentanoyl]-3-phenyl-5,6,8,9-tetrahydroimidazo[1,5-d][1,4]diazepine-7-carboxylate (PubChem CID 58054191) has the molecular formula C27H38N4O4 and a molecular weight of 482.63 g/mol. Its IUPAC name is tert-butyl 1-[(3S)-4,4-dimethyl-3-(methylcarbamoyl)pentanoyl]-3-phenyl-5,6,8,9-tetrahydroimidazo[1,5-d][1,4]diazepine-7-carboxylate.
| Compound Name | tert-butyl 1-[(3S)-4,4-dimethyl-3-(methylcarbamoyl)pentanoyl]-3-phenyl-5,6,8,9-tetrahydroimidazo[1,5-d][1,4]diazepine-7-carboxylate |
|---|---|
| PubChem CID | 58054191 |
| Molecular Formula | C27H38N4O4 |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.29 |
| IUPAC Name | tert-butyl 1-[(3S)-4,4-dimethyl-3-(methylcarbamoyl)pentanoyl]-3-phenyl-5,6,8,9-tetrahydroimidazo[1,5-d][1,4]diazepine-7-carboxylate |
| SMILES | CNC(=O)[C@@H](CC(=O)c1nc(-c2ccccc2)n2c1CCN(C(=O)OC(C)(C)C)CC2)C(C)(C)C |
| InChI | InChI=1S/C27H38N4O4/c1-26(2,3)19(24(33)28-7)17-21(32)22-20-13-14-30(25(34)35-27(4,5)6)15-16-31(20)23(29-22)18-11-9-8-10-12-18/h8-12,19H,13-17H2,1-7H3,(H,28,33)/t19-/m1/s1 |
| InChIKey | NUDYQKHSEPUTQM-LJQANCHMSA-N |
| XLogP | 4.32 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |