C22H27F3N4O3 — CID 58054219
3-(3,4-difluorophenyl)-N-[(2S)-1-(2-fluoroethylamino)-3,3-dimethyl-1-oxobutan-2-yl]-5,6,7,9-tetrahydroimidazo[5,1-c][1,4]oxazepine-1-carboxamide (PubChem CID 58054219) has the molecular formula C22H27F3N4O3 and a molecular weight of 452.48 g/mol. Its IUPAC name is 3-(3,4-difluorophenyl)-N-[(2S)-1-(2-fluoroethylamino)-3,3-dimethyl-1-oxobutan-2-yl]-5,6,7,9-tetrahydroimidazo[5,1-c][1,4]oxazepine-1-carboxamide.
| Compound Name | 3-(3,4-difluorophenyl)-N-[(2S)-1-(2-fluoroethylamino)-3,3-dimethyl-1-oxobutan-2-yl]-5,6,7,9-tetrahydroimidazo[5,1-c][1,4]oxazepine-1-carboxamide |
|---|---|
| PubChem CID | 58054219 |
| Molecular Formula | C22H27F3N4O3 |
| Molecular Weight | 452.48 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | 3-(3,4-difluorophenyl)-N-[(2S)-1-(2-fluoroethylamino)-3,3-dimethyl-1-oxobutan-2-yl]-5,6,7,9-tetrahydroimidazo[5,1-c][1,4]oxazepine-1-carboxamide |
| SMILES | CC(C)(C)[C@H](NC(=O)c1nc(-c2ccc(F)c(F)c2)n2c1COCCC2)C(=O)NCCF |
| InChI | InChI=1S/C22H27F3N4O3/c1-22(2,3)18(21(31)26-8-7-23)28-20(30)17-16-12-32-10-4-9-29(16)19(27-17)13-5-6-14(24)15(25)11-13/h5-6,11,18H,4,7-10,12H2,1-3H3,(H,26,31)(H,28,30)/t18-/m1/s1 |
| InChIKey | OQHXZOOSYBTTOT-GOSISDBHSA-N |
| XLogP | 2.98 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.48 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |