C24H32F2N4O2 — CID 58054232
(2S)-2-[2-[3-(3,4-difluorophenyl)-6,8-dimethyl-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-1-yl]-2-oxoethyl]-N,3,3-trimethylbutanamide (PubChem CID 58054232) has the molecular formula C24H32F2N4O2 and a molecular weight of 446.54 g/mol. Its IUPAC name is (2S)-2-[2-[3-(3,4-difluorophenyl)-6,8-dimethyl-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-1-yl]-2-oxoethyl]-N,3,3-trimethylbutanamide.
| Compound Name | (2S)-2-[2-[3-(3,4-difluorophenyl)-6,8-dimethyl-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-1-yl]-2-oxoethyl]-N,3,3-trimethylbutanamide |
|---|---|
| PubChem CID | 58054232 |
| Molecular Formula | C24H32F2N4O2 |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.25 |
| IUPAC Name | (2S)-2-[2-[3-(3,4-difluorophenyl)-6,8-dimethyl-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-1-yl]-2-oxoethyl]-N,3,3-trimethylbutanamide |
| SMILES | CNC(=O)[C@@H](CC(=O)c1nc(-c2ccc(F)c(F)c2)n2c1CN(C)CC(C)C2)C(C)(C)C |
| InChI | InChI=1S/C24H32F2N4O2/c1-14-11-29(6)13-19-21(20(31)10-16(23(32)27-5)24(2,3)4)28-22(30(19)12-14)15-7-8-17(25)18(26)9-15/h7-9,14,16H,10-13H2,1-6H3,(H,27,32)/t14?,16-/m1/s1 |
| InChIKey | UNHRKWXKXDEEJE-BZSJEYESSA-N |
| XLogP | 3.89 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |