C22H27F2N3O3 — CID 58054243
(2S)-2-[2-[3-(2,5-difluorophenyl)-5,6,7,9-tetrahydroimidazo[5,1-c][1,4]oxazepin-1-yl]-2-oxoethyl]-N,3,3-trimethylbutanamide (PubChem CID 58054243) has the molecular formula C22H27F2N3O3 and a molecular weight of 419.47 g/mol. Its IUPAC name is (2S)-2-[2-[3-(2,5-difluorophenyl)-5,6,7,9-tetrahydroimidazo[5,1-c][1,4]oxazepin-1-yl]-2-oxoethyl]-N,3,3-trimethylbutanamide.
| Compound Name | (2S)-2-[2-[3-(2,5-difluorophenyl)-5,6,7,9-tetrahydroimidazo[5,1-c][1,4]oxazepin-1-yl]-2-oxoethyl]-N,3,3-trimethylbutanamide |
|---|---|
| PubChem CID | 58054243 |
| Molecular Formula | C22H27F2N3O3 |
| Molecular Weight | 419.47 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | (2S)-2-[2-[3-(2,5-difluorophenyl)-5,6,7,9-tetrahydroimidazo[5,1-c][1,4]oxazepin-1-yl]-2-oxoethyl]-N,3,3-trimethylbutanamide |
| SMILES | CNC(=O)[C@@H](CC(=O)c1nc(-c2cc(F)ccc2F)n2c1COCCC2)C(C)(C)C |
| InChI | InChI=1S/C22H27F2N3O3/c1-22(2,3)15(21(29)25-4)11-18(28)19-17-12-30-9-5-8-27(17)20(26-19)14-10-13(23)6-7-16(14)24/h6-7,10,15H,5,8-9,11-12H2,1-4H3,(H,25,29)/t15-/m1/s1 |
| InChIKey | JQXXLLTYIZTNFU-OAHLLOKOSA-N |
| XLogP | 3.73 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.47 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |