C25H34F2N4O2 — CID 58054250
(2S)-2-[2-[3-(3,4-difluorophenyl)-6,6,8-trimethyl-7,9-dihydro-5H-imidazo[1,5-a][1,4]diazepin-1-yl]-2-oxoethyl]-N,3,3-trimethylbutanamide (PubChem CID 58054250) has the molecular formula C25H34F2N4O2 and a molecular weight of 460.57 g/mol. Its IUPAC name is (2S)-2-[2-[3-(3,4-difluorophenyl)-6,6,8-trimethyl-7,9-dihydro-5H-imidazo[1,5-a][1,4]diazepin-1-yl]-2-oxoethyl]-N,3,3-trimethylbutanamide.
| Compound Name | (2S)-2-[2-[3-(3,4-difluorophenyl)-6,6,8-trimethyl-7,9-dihydro-5H-imidazo[1,5-a][1,4]diazepin-1-yl]-2-oxoethyl]-N,3,3-trimethylbutanamide |
|---|---|
| PubChem CID | 58054250 |
| Molecular Formula | C25H34F2N4O2 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.26 |
| IUPAC Name | (2S)-2-[2-[3-(3,4-difluorophenyl)-6,6,8-trimethyl-7,9-dihydro-5H-imidazo[1,5-a][1,4]diazepin-1-yl]-2-oxoethyl]-N,3,3-trimethylbutanamide |
| SMILES | CNC(=O)[C@@H](CC(=O)c1nc(-c2ccc(F)c(F)c2)n2c1CN(C)CC(C)(C)C2)C(C)(C)C |
| InChI | InChI=1S/C25H34F2N4O2/c1-24(2,3)16(23(33)28-6)11-20(32)21-19-12-30(7)13-25(4,5)14-31(19)22(29-21)15-8-9-17(26)18(27)10-15/h8-10,16H,11-14H2,1-7H3,(H,28,33)/t16-/m1/s1 |
| InChIKey | GIHAISOJFZYAIT-MRXNPFEDSA-N |
| XLogP | 4.28 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |