C21H25F3N4O3 — CID 58054257
N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-3-(2,4,5-trifluorophenyl)-5,6,7,9-tetrahydroimidazo[5,1-c][1,4]oxazepine-1-carboxamide (PubChem CID 58054257) has the molecular formula C21H25F3N4O3 and a molecular weight of 438.45 g/mol. Its IUPAC name is N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-3-(2,4,5-trifluorophenyl)-5,6,7,9-tetrahydroimidazo[5,1-c][1,4]oxazepine-1-carboxamide.
| Compound Name | N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-3-(2,4,5-trifluorophenyl)-5,6,7,9-tetrahydroimidazo[5,1-c][1,4]oxazepine-1-carboxamide |
|---|---|
| PubChem CID | 58054257 |
| Molecular Formula | C21H25F3N4O3 |
| Molecular Weight | 438.45 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-3-(2,4,5-trifluorophenyl)-5,6,7,9-tetrahydroimidazo[5,1-c][1,4]oxazepine-1-carboxamide |
| SMILES | CNC(=O)[C@@H](NC(=O)c1nc(-c2cc(F)c(F)cc2F)n2c1COCCC2)C(C)(C)C |
| InChI | InChI=1S/C21H25F3N4O3/c1-21(2,3)17(20(30)25-4)27-19(29)16-15-10-31-7-5-6-28(15)18(26-16)11-8-13(23)14(24)9-12(11)22/h8-9,17H,5-7,10H2,1-4H3,(H,25,30)(H,27,29)/t17-/m1/s1 |
| InChIKey | PDYPPKHBOBMWTF-QGZVFWFLSA-N |
| XLogP | 2.78 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.45 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|