C22H18N4OS — CID 58054798
(5-methyl-4-phenyl-3,4,9,11-tetrazatricyclo[8.4.0.02,6]tetradeca-1(10),2,5,11,13-pentaen-9-yl)-thiophen-2-ylmethanone (PubChem CID 58054798) has the molecular formula C22H18N4OS and a molecular weight of 386.48 g/mol. Its IUPAC name is (5-methyl-4-phenyl-3,4,9,11-tetrazatricyclo[8.4.0.02,6]tetradeca-1(10),2,5,11,13-pentaen-9-yl)-thiophen-2-ylmethanone.
| Compound Name | (5-methyl-4-phenyl-3,4,9,11-tetrazatricyclo[8.4.0.02,6]tetradeca-1(10),2,5,11,13-pentaen-9-yl)-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 58054798 |
| Molecular Formula | C22H18N4OS |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | (5-methyl-4-phenyl-3,4,9,11-tetrazatricyclo[8.4.0.02,6]tetradeca-1(10),2,5,11,13-pentaen-9-yl)-thiophen-2-ylmethanone |
| SMILES | Cc1c2c(nn1-c1ccccc1)-c1cccnc1N(C(=O)c1cccs1)CC2 |
| InChI | InChI=1S/C22H18N4OS/c1-15-17-11-13-25(22(27)19-10-6-14-28-19)21-18(9-5-12-23-21)20(17)24-26(15)16-7-3-2-4-8-16/h2-10,12,14H,11,13H2,1H3 |
| InChIKey | HKBFNUWAPTUGEK-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |