C27H36N2O3 — CID 58054894
4-(cyclopropylmethoxy)-N-[(2S)-6-[(2-ethoxyethylamino)methyl]-1,2,3,4-tetrahydronaphthalen-2-yl]-N-methylbenzamide (PubChem CID 58054894) has the molecular formula C27H36N2O3 and a molecular weight of 436.60 g/mol. Its IUPAC name is 4-(cyclopropylmethoxy)-N-[(2S)-6-[(2-ethoxyethylamino)methyl]-1,2,3,4-tetrahydronaphthalen-2-yl]-N-methylbenzamide.
| Compound Name | 4-(cyclopropylmethoxy)-N-[(2S)-6-[(2-ethoxyethylamino)methyl]-1,2,3,4-tetrahydronaphthalen-2-yl]-N-methylbenzamide |
|---|---|
| PubChem CID | 58054894 |
| Molecular Formula | C27H36N2O3 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.27 |
| IUPAC Name | 4-(cyclopropylmethoxy)-N-[(2S)-6-[(2-ethoxyethylamino)methyl]-1,2,3,4-tetrahydronaphthalen-2-yl]-N-methylbenzamide |
| SMILES | CCOCCNCc1ccc2c(c1)CC[C@H](N(C)C(=O)c1ccc(OCC3CC3)cc1)C2 |
| InChI | InChI=1S/C27H36N2O3/c1-3-31-15-14-28-18-21-6-7-24-17-25(11-8-23(24)16-21)29(2)27(30)22-9-12-26(13-10-22)32-19-20-4-5-20/h6-7,9-10,12-13,16,20,25,28H,3-5,8,11,14-15,17-19H2,1-2H3/t25-/m0/s1 |
| InChIKey | QMWVTIGTIADHPK-VWLOTQADSA-N |
| XLogP | 4.23 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|