About tert-butyl (3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-3-prop-2-enylpyrrolidine-1-carboxylate
tert-butyl (3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-3-prop-2-enylpyrrolidine-1-carboxylate (PubChem CID 58055032) has the molecular formula C19H37NO4Si
and a molecular weight of 371.59 g/mol. Its IUPAC name is tert-butyl (3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-3-prop-2-enylpyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-3-prop-2-enylpyrrolidine-1-carboxylate |
| PubChem CID | 58055032 |
| Molecular Formula | C19H37NO4Si |
| Molecular Weight | 371.59 g/mol |
| Exact Mass | 371.25 |
| IUPAC Name | tert-butyl (3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-3-prop-2-enylpyrrolidine-1-carboxylate |
| SMILES | C=CC[C@@]1(OC)CN(C(=O)OC(C)(C)C)C[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H37NO4Si/c1-11-12-19(22-8)14-20(16(21)23-17(2,3)4)13-15(19)24-25(9,10)18(5,6)7/h11,15H,1,12-14H2,2-10H3/t15-,19+/m0/s1 |
| InChIKey | NOPFTANOGVMXFA-HNAYVOBHSA-N |
| XLogP | 4.59 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.59 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-3-prop-2-enylpyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-3-prop-2-enylpyrrolidine-1-carboxylate?
The IUPAC name of tert-butyl (3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-3-prop-2-enylpyrrolidine-1-carboxylate (CID 58055032) is tert-butyl (3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-3-prop-2-enylpyrrolidine-1-carboxylate.
What is the SMILES notation for tert-butyl (3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-3-prop-2-enylpyrrolidine-1-carboxylate?
The canonical SMILES for tert-butyl (3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-3-prop-2-enylpyrrolidine-1-carboxylate is C=CC[C@@]1(OC)CN(C(=O)OC(C)(C)C)C[C@@H]1O[Si](C)(C)C(C)(C)C.
What is the InChIKey of tert-butyl (3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-3-prop-2-enylpyrrolidine-1-carboxylate?
The InChIKey is NOPFTANOGVMXFA-HNAYVOBHSA-N. The full InChI is InChI=1S/C19H37NO4Si/c1-11-12-19(22-8)14-20(16(21)23-17(2,3)4)13-15(19)24-25(9,10)18(5,6)7/h11,15H,1,12-14H2,2-10H3/t15-,19+/m0/s1.
What are the key properties of tert-butyl (3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-3-prop-2-enylpyrrolidine-1-carboxylate?
tert-butyl (3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-3-prop-2-enylpyrrolidine-1-carboxylate has a molecular weight of 371.59 g/mol, XLogP of 4.59, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-3-prop-2-enylpyrrolidine-1-carboxylate is sourced from PubChem (CID 58055032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).