C12H22N2O3 — CID 58055039
tert-butyl (3aR,6aR)-3a-methoxy-1,2,3,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxylate (PubChem CID 58055039) has the molecular formula C12H22N2O3 and a molecular weight of 242.32 g/mol. Its IUPAC name is tert-butyl (3aR,6aR)-3a-methoxy-1,2,3,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxylate.
| Compound Name | tert-butyl (3aR,6aR)-3a-methoxy-1,2,3,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 58055039 |
| Molecular Formula | C12H22N2O3 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | tert-butyl (3aR,6aR)-3a-methoxy-1,2,3,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxylate |
| SMILES | CO[C@@]12CCN[C@@H]1CN(C(=O)OC(C)(C)C)C2 |
| InChI | InChI=1S/C12H22N2O3/c1-11(2,3)17-10(15)14-7-9-12(8-14,16-4)5-6-13-9/h9,13H,5-8H2,1-4H3/t9-,12-/m1/s1 |
| InChIKey | SJQIDPOIMSYNSJ-BXKDBHETSA-N |
| XLogP | 0.98 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |