C22H32N2O3 — CID 58055301
N-hydroxy-7-[2-(4-methyl-1-propan-2-ylpiperidin-4-yl)-2-oxoethyl]-1,2,3,4-tetrahydronaphthalene-2-carboxamide (PubChem CID 58055301) has the molecular formula C22H32N2O3 and a molecular weight of 372.51 g/mol. Its IUPAC name is N-hydroxy-7-[2-(4-methyl-1-propan-2-ylpiperidin-4-yl)-2-oxoethyl]-1,2,3,4-tetrahydronaphthalene-2-carboxamide.
| Compound Name | N-hydroxy-7-[2-(4-methyl-1-propan-2-ylpiperidin-4-yl)-2-oxoethyl]-1,2,3,4-tetrahydronaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 58055301 |
| Molecular Formula | C22H32N2O3 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.24 |
| IUPAC Name | N-hydroxy-7-[2-(4-methyl-1-propan-2-ylpiperidin-4-yl)-2-oxoethyl]-1,2,3,4-tetrahydronaphthalene-2-carboxamide |
| SMILES | CC(C)N1CCC(C)(C(=O)Cc2ccc3c(c2)CC(C(=O)NO)CC3)CC1 |
| InChI | InChI=1S/C22H32N2O3/c1-15(2)24-10-8-22(3,9-11-24)20(25)13-16-4-5-17-6-7-18(21(26)23-27)14-19(17)12-16/h4-5,12,15,18,27H,6-11,13-14H2,1-3H3,(H,23,26) |
| InChIKey | ZZWKLROLMHYMSU-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|