C20H20N4O3 — CID 58055582
N-[6-(hydroxycarbamoyl)-1,2,3,4-tetrahydronaphthalen-2-yl]-2-methylimidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 58055582) has the molecular formula C20H20N4O3 and a molecular weight of 364.41 g/mol. Its IUPAC name is N-[6-(hydroxycarbamoyl)-1,2,3,4-tetrahydronaphthalen-2-yl]-2-methylimidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | N-[6-(hydroxycarbamoyl)-1,2,3,4-tetrahydronaphthalen-2-yl]-2-methylimidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 58055582 |
| Molecular Formula | C20H20N4O3 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | N-[6-(hydroxycarbamoyl)-1,2,3,4-tetrahydronaphthalen-2-yl]-2-methylimidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | Cc1nc2ccccn2c1C(=O)NC1CCc2cc(C(=O)NO)ccc2C1 |
| InChI | InChI=1S/C20H20N4O3/c1-12-18(24-9-3-2-4-17(24)21-12)20(26)22-16-8-7-13-10-15(19(25)23-27)6-5-14(13)11-16/h2-6,9-10,16,27H,7-8,11H2,1H3,(H,22,26)(H,23,25) |
| InChIKey | RFMHVOQHYCSMIO-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 95.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|