C18H26N2O3 — CID 58055583
6-(2,2-dimethylpropanoylamino)-N-hydroxy-8,8-dimethyl-6,7-dihydro-5H-naphthalene-2-carboxamide (PubChem CID 58055583) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is 6-(2,2-dimethylpropanoylamino)-N-hydroxy-8,8-dimethyl-6,7-dihydro-5H-naphthalene-2-carboxamide.
| Compound Name | 6-(2,2-dimethylpropanoylamino)-N-hydroxy-8,8-dimethyl-6,7-dihydro-5H-naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 58055583 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | 6-(2,2-dimethylpropanoylamino)-N-hydroxy-8,8-dimethyl-6,7-dihydro-5H-naphthalene-2-carboxamide |
| SMILES | CC(C)(C)C(=O)NC1Cc2ccc(C(=O)NO)cc2C(C)(C)C1 |
| InChI | InChI=1S/C18H26N2O3/c1-17(2,3)16(22)19-13-8-11-6-7-12(15(21)20-23)9-14(11)18(4,5)10-13/h6-7,9,13,23H,8,10H2,1-5H3,(H,19,22)(H,20,21) |
| InChIKey | VBCQAMSUDJZFMQ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|