C16H22N2O2 — CID 58055632
N-hydroxy-6-piperidin-4-yl-5,6,7,8-tetrahydronaphthalene-2-carboxamide (PubChem CID 58055632) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is N-hydroxy-6-piperidin-4-yl-5,6,7,8-tetrahydronaphthalene-2-carboxamide.
| Compound Name | N-hydroxy-6-piperidin-4-yl-5,6,7,8-tetrahydronaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 58055632 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | N-hydroxy-6-piperidin-4-yl-5,6,7,8-tetrahydronaphthalene-2-carboxamide |
| SMILES | O=C(NO)c1ccc2c(c1)CCC(C1CCNCC1)C2 |
| InChI | InChI=1S/C16H22N2O2/c19-16(18-20)15-4-3-13-9-12(1-2-14(13)10-15)11-5-7-17-8-6-11/h3-4,10-12,17,20H,1-2,5-9H2,(H,18,19) |
| InChIKey | ZFJKPPBGGPFHTA-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|