About 1-tert-butyl-4-(3,3-difluoro-4,4-dimethylpentyl)piperazine
1-tert-butyl-4-(3,3-difluoro-4,4-dimethylpentyl)piperazine (PubChem CID 58055843) has the molecular formula C15H30F2N2
and a molecular weight of 276.41 g/mol. Its IUPAC name is 1-tert-butyl-4-(3,3-difluoro-4,4-dimethylpentyl)piperazine.
Molecular Properties
| Compound Name | 1-tert-butyl-4-(3,3-difluoro-4,4-dimethylpentyl)piperazine |
| PubChem CID | 58055843 |
| Molecular Formula | C15H30F2N2 |
| Molecular Weight | 276.41 g/mol |
| Exact Mass | 276.24 |
| IUPAC Name | 1-tert-butyl-4-(3,3-difluoro-4,4-dimethylpentyl)piperazine |
| SMILES | CC(C)(C)N1CCN(CCC(F)(F)C(C)(C)C)CC1 |
| InChI | InChI=1S/C15H30F2N2/c1-13(2,3)15(16,17)7-8-18-9-11-19(12-10-18)14(4,5)6/h7-12H2,1-6H3 |
| InChIKey | UFJHNJJUBBJCHI-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.41 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-tert-butyl-4-(3,3-difluoro-4,4-dimethylpentyl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-4-(3,3-difluoro-4,4-dimethylpentyl)piperazine?
The IUPAC name of 1-tert-butyl-4-(3,3-difluoro-4,4-dimethylpentyl)piperazine (CID 58055843) is 1-tert-butyl-4-(3,3-difluoro-4,4-dimethylpentyl)piperazine.
What is the SMILES notation for 1-tert-butyl-4-(3,3-difluoro-4,4-dimethylpentyl)piperazine?
The canonical SMILES for 1-tert-butyl-4-(3,3-difluoro-4,4-dimethylpentyl)piperazine is CC(C)(C)N1CCN(CCC(F)(F)C(C)(C)C)CC1.
What is the InChIKey of 1-tert-butyl-4-(3,3-difluoro-4,4-dimethylpentyl)piperazine?
The InChIKey is UFJHNJJUBBJCHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30F2N2/c1-13(2,3)15(16,17)7-8-18-9-11-19(12-10-18)14(4,5)6/h7-12H2,1-6H3.
What are the key properties of 1-tert-butyl-4-(3,3-difluoro-4,4-dimethylpentyl)piperazine?
1-tert-butyl-4-(3,3-difluoro-4,4-dimethylpentyl)piperazine has a molecular weight of 276.41 g/mol, XLogP of 3.47, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-4-(3,3-difluoro-4,4-dimethylpentyl)piperazine is sourced from PubChem (CID 58055843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).