About 4,4-di(propan-2-yl)-2,3-dihydrothiopyran
4,4-di(propan-2-yl)-2,3-dihydrothiopyran (PubChem CID 58055974) has the molecular formula C11H20S
and a molecular weight of 184.35 g/mol. Its IUPAC name is 4,4-di(propan-2-yl)-2,3-dihydrothiopyran.
Molecular Properties
| Compound Name | 4,4-di(propan-2-yl)-2,3-dihydrothiopyran |
| PubChem CID | 58055974 |
| Molecular Formula | C11H20S |
| Molecular Weight | 184.35 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | 4,4-di(propan-2-yl)-2,3-dihydrothiopyran |
| SMILES | CC(C)C1(C(C)C)C=CSCC1 |
| InChI | InChI=1S/C11H20S/c1-9(2)11(10(3)4)5-7-12-8-6-11/h5,7,9-10H,6,8H2,1-4H3 |
| InChIKey | KUHVPSXCUROQFB-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.35 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4,4-di(propan-2-yl)-2,3-dihydrothiopyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-di(propan-2-yl)-2,3-dihydrothiopyran?
The IUPAC name of 4,4-di(propan-2-yl)-2,3-dihydrothiopyran (CID 58055974) is 4,4-di(propan-2-yl)-2,3-dihydrothiopyran.
What is the SMILES notation for 4,4-di(propan-2-yl)-2,3-dihydrothiopyran?
The canonical SMILES for 4,4-di(propan-2-yl)-2,3-dihydrothiopyran is CC(C)C1(C(C)C)C=CSCC1.
What is the InChIKey of 4,4-di(propan-2-yl)-2,3-dihydrothiopyran?
The InChIKey is KUHVPSXCUROQFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20S/c1-9(2)11(10(3)4)5-7-12-8-6-11/h5,7,9-10H,6,8H2,1-4H3.
What are the key properties of 4,4-di(propan-2-yl)-2,3-dihydrothiopyran?
4,4-di(propan-2-yl)-2,3-dihydrothiopyran has a molecular weight of 184.35 g/mol, XLogP of 3.94, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-di(propan-2-yl)-2,3-dihydrothiopyran is sourced from PubChem (CID 58055974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).