About 3,3-di(propan-2-yl)-2,4-dihydro-1H-pyridine
3,3-di(propan-2-yl)-2,4-dihydro-1H-pyridine (PubChem CID 58055997) has the molecular formula C11H21N
and a molecular weight of 167.30 g/mol. Its IUPAC name is 3,3-di(propan-2-yl)-2,4-dihydro-1H-pyridine.
Molecular Properties
| Compound Name | 3,3-di(propan-2-yl)-2,4-dihydro-1H-pyridine |
| PubChem CID | 58055997 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | 3,3-di(propan-2-yl)-2,4-dihydro-1H-pyridine |
| SMILES | CC(C)C1(C(C)C)CC=CNC1 |
| InChI | InChI=1S/C11H21N/c1-9(2)11(10(3)4)6-5-7-12-8-11/h5,7,9-10,12H,6,8H2,1-4H3 |
| InChIKey | BITAIGHDMRABLY-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,3-di(propan-2-yl)-2,4-dihydro-1H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-di(propan-2-yl)-2,4-dihydro-1H-pyridine?
The IUPAC name of 3,3-di(propan-2-yl)-2,4-dihydro-1H-pyridine (CID 58055997) is 3,3-di(propan-2-yl)-2,4-dihydro-1H-pyridine.
What is the SMILES notation for 3,3-di(propan-2-yl)-2,4-dihydro-1H-pyridine?
The canonical SMILES for 3,3-di(propan-2-yl)-2,4-dihydro-1H-pyridine is CC(C)C1(C(C)C)CC=CNC1.
What is the InChIKey of 3,3-di(propan-2-yl)-2,4-dihydro-1H-pyridine?
The InChIKey is BITAIGHDMRABLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N/c1-9(2)11(10(3)4)6-5-7-12-8-11/h5,7,9-10,12H,6,8H2,1-4H3.
What are the key properties of 3,3-di(propan-2-yl)-2,4-dihydro-1H-pyridine?
3,3-di(propan-2-yl)-2,4-dihydro-1H-pyridine has a molecular weight of 167.30 g/mol, XLogP of 2.79, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-di(propan-2-yl)-2,4-dihydro-1H-pyridine is sourced from PubChem (CID 58055997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).