About 3,3-di(propan-2-yl)pyrrole
3,3-di(propan-2-yl)pyrrole (PubChem CID 58056046) has the molecular formula C10H17N
and a molecular weight of 151.25 g/mol. Its IUPAC name is 3,3-di(propan-2-yl)pyrrole.
Molecular Properties
| Compound Name | 3,3-di(propan-2-yl)pyrrole |
| PubChem CID | 58056046 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | 3,3-di(propan-2-yl)pyrrole |
| SMILES | CC(C)C1(C(C)C)C=CN=C1 |
| InChI | InChI=1S/C10H17N/c1-8(2)10(9(3)4)5-6-11-7-10/h5-9H,1-4H3 |
| InChIKey | PTIPDONKVGDMDT-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,3-di(propan-2-yl)pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-di(propan-2-yl)pyrrole?
The IUPAC name of 3,3-di(propan-2-yl)pyrrole (CID 58056046) is 3,3-di(propan-2-yl)pyrrole.
What is the SMILES notation for 3,3-di(propan-2-yl)pyrrole?
The canonical SMILES for 3,3-di(propan-2-yl)pyrrole is CC(C)C1(C(C)C)C=CN=C1.
What is the InChIKey of 3,3-di(propan-2-yl)pyrrole?
The InChIKey is PTIPDONKVGDMDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N/c1-8(2)10(9(3)4)5-6-11-7-10/h5-9H,1-4H3.
What are the key properties of 3,3-di(propan-2-yl)pyrrole?
3,3-di(propan-2-yl)pyrrole has a molecular weight of 151.25 g/mol, XLogP of 2.88, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-di(propan-2-yl)pyrrole is sourced from PubChem (CID 58056046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).