About 3-[1-[3-(2,4-dimethoxypyrimidin-5-yl)phenyl]sulfonyl-5-fluoroindol-3-yl]propanoic acid
3-[1-[3-(2,4-dimethoxypyrimidin-5-yl)phenyl]sulfonyl-5-fluoroindol-3-yl]propanoic acid (PubChem CID 58056517) has the molecular formula C23H20FN3O6S
and a molecular weight of 485.49 g/mol. Its IUPAC name is 3-[1-[3-(2,4-dimethoxypyrimidin-5-yl)phenyl]sulfonyl-5-fluoroindol-3-yl]propanoic acid.
Molecular Properties
| Compound Name | 3-[1-[3-(2,4-dimethoxypyrimidin-5-yl)phenyl]sulfonyl-5-fluoroindol-3-yl]propanoic acid |
| PubChem CID | 58056517 |
| Molecular Formula | C23H20FN3O6S |
| Molecular Weight | 485.49 g/mol |
| Exact Mass | 485.11 |
| IUPAC Name | 3-[1-[3-(2,4-dimethoxypyrimidin-5-yl)phenyl]sulfonyl-5-fluoroindol-3-yl]propanoic acid |
| SMILES | COc1ncc(-c2cccc(S(=O)(=O)n3cc(CCC(=O)O)c4cc(F)ccc43)c2)c(OC)n1 |
| InChI | InChI=1S/C23H20FN3O6S/c1-32-22-19(12-25-23(26-22)33-2)14-4-3-5-17(10-14)34(30,31)27-13-15(6-9-21(28)29)18-11-16(24)7-8-20(18)27/h3-5,7-8,10-13H,6,9H2,1-2H3,(H,28,29) |
| InChIKey | ZVGQARPBYFISJF-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 120.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 485.49 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 3-[1-[3-(2,4-dimethoxypyrimidin-5-yl)phenyl]sulfonyl-5-fluoroindol-3-yl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-[3-(2,4-dimethoxypyrimidin-5-yl)phenyl]sulfonyl-5-fluoroindol-3-yl]propanoic acid?
The IUPAC name of 3-[1-[3-(2,4-dimethoxypyrimidin-5-yl)phenyl]sulfonyl-5-fluoroindol-3-yl]propanoic acid (CID 58056517) is 3-[1-[3-(2,4-dimethoxypyrimidin-5-yl)phenyl]sulfonyl-5-fluoroindol-3-yl]propanoic acid.
What is the SMILES notation for 3-[1-[3-(2,4-dimethoxypyrimidin-5-yl)phenyl]sulfonyl-5-fluoroindol-3-yl]propanoic acid?
The canonical SMILES for 3-[1-[3-(2,4-dimethoxypyrimidin-5-yl)phenyl]sulfonyl-5-fluoroindol-3-yl]propanoic acid is COc1ncc(-c2cccc(S(=O)(=O)n3cc(CCC(=O)O)c4cc(F)ccc43)c2)c(OC)n1.
What is the InChIKey of 3-[1-[3-(2,4-dimethoxypyrimidin-5-yl)phenyl]sulfonyl-5-fluoroindol-3-yl]propanoic acid?
The InChIKey is ZVGQARPBYFISJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20FN3O6S/c1-32-22-19(12-25-23(26-22)33-2)14-4-3-5-17(10-14)34(30,31)27-13-15(6-9-21(28)29)18-11-16(24)7-8-20(18)27/h3-5,7-8,10-13H,6,9H2,1-2H3,(H,28,29).
What are the key properties of 3-[1-[3-(2,4-dimethoxypyrimidin-5-yl)phenyl]sulfonyl-5-fluoroindol-3-yl]propanoic acid?
3-[1-[3-(2,4-dimethoxypyrimidin-5-yl)phenyl]sulfonyl-5-fluoroindol-3-yl]propanoic acid has a molecular weight of 485.49 g/mol, XLogP of 3.51, 8 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-[3-(2,4-dimethoxypyrimidin-5-yl)phenyl]sulfonyl-5-fluoroindol-3-yl]propanoic acid is sourced from PubChem (CID 58056517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).