About 2-[(4-fluorophenyl)-dihydroxy-λ4-sulfanyl]-N'-hydroxy-2-methylpropanimidamide
2-[(4-fluorophenyl)-dihydroxy-λ4-sulfanyl]-N'-hydroxy-2-methylpropanimidamide (PubChem CID 58057084) has the molecular formula C10H15FN2O3S
and a molecular weight of 262.31 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)-dihydroxy-λ4-sulfanyl]-N'-hydroxy-2-methylpropanimidamide.
Molecular Properties
| Compound Name | 2-[(4-fluorophenyl)-dihydroxy-λ4-sulfanyl]-N'-hydroxy-2-methylpropanimidamide |
| PubChem CID | 58057084 |
| Molecular Formula | C10H15FN2O3S |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 2-[(4-fluorophenyl)-dihydroxy-λ4-sulfanyl]-N'-hydroxy-2-methylpropanimidamide |
| SMILES | CC(C)(/C(N)=N/O)S(O)(O)c1ccc(F)cc1 |
| InChI | InChI=1S/C10H15FN2O3S/c1-10(2,9(12)13-14)17(15,16)8-5-3-7(11)4-6-8/h3-6,14-16H,1-2H3,(H2,12,13) |
| InChIKey | SGJSNFIKTYZAPB-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(4-fluorophenyl)-dihydroxy-λ4-sulfanyl]-N'-hydroxy-2-methylpropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-fluorophenyl)-dihydroxy-λ4-sulfanyl]-N'-hydroxy-2-methylpropanimidamide?
The IUPAC name of 2-[(4-fluorophenyl)-dihydroxy-λ4-sulfanyl]-N'-hydroxy-2-methylpropanimidamide (CID 58057084) is 2-[(4-fluorophenyl)-dihydroxy-λ4-sulfanyl]-N'-hydroxy-2-methylpropanimidamide.
What is the SMILES notation for 2-[(4-fluorophenyl)-dihydroxy-λ4-sulfanyl]-N'-hydroxy-2-methylpropanimidamide?
The canonical SMILES for 2-[(4-fluorophenyl)-dihydroxy-λ4-sulfanyl]-N'-hydroxy-2-methylpropanimidamide is CC(C)(/C(N)=N/O)S(O)(O)c1ccc(F)cc1.
What is the InChIKey of 2-[(4-fluorophenyl)-dihydroxy-λ4-sulfanyl]-N'-hydroxy-2-methylpropanimidamide?
The InChIKey is SGJSNFIKTYZAPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15FN2O3S/c1-10(2,9(12)13-14)17(15,16)8-5-3-7(11)4-6-8/h3-6,14-16H,1-2H3,(H2,12,13).
What are the key properties of 2-[(4-fluorophenyl)-dihydroxy-λ4-sulfanyl]-N'-hydroxy-2-methylpropanimidamide?
2-[(4-fluorophenyl)-dihydroxy-λ4-sulfanyl]-N'-hydroxy-2-methylpropanimidamide has a molecular weight of 262.31 g/mol, XLogP of 2.46, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-fluorophenyl)-dihydroxy-λ4-sulfanyl]-N'-hydroxy-2-methylpropanimidamide is sourced from PubChem (CID 58057084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).