About 3-tert-butyl-1,2-oxazole-5-carboximidamide
3-tert-butyl-1,2-oxazole-5-carboximidamide (PubChem CID 58057178) has the molecular formula C8H13N3O
and a molecular weight of 167.21 g/mol. Its IUPAC name is 3-tert-butyl-1,2-oxazole-5-carboximidamide.
Molecular Properties
| Compound Name | 3-tert-butyl-1,2-oxazole-5-carboximidamide |
| PubChem CID | 58057178 |
| Molecular Formula | C8H13N3O |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | 3-tert-butyl-1,2-oxazole-5-carboximidamide |
| SMILES | [H]/N=C(\N)c1cc(C(C)(C)C)no1 |
| InChI | InChI=1S/C8H13N3O/c1-8(2,3)6-4-5(7(9)10)12-11-6/h4H,1-3H3,(H3,9,10) |
| InChIKey | YFJIYKJECMZVIY-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 75.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-tert-butyl-1,2-oxazole-5-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-1,2-oxazole-5-carboximidamide?
The IUPAC name of 3-tert-butyl-1,2-oxazole-5-carboximidamide (CID 58057178) is 3-tert-butyl-1,2-oxazole-5-carboximidamide.
What is the SMILES notation for 3-tert-butyl-1,2-oxazole-5-carboximidamide?
The canonical SMILES for 3-tert-butyl-1,2-oxazole-5-carboximidamide is [H]/N=C(\N)c1cc(C(C)(C)C)no1.
What is the InChIKey of 3-tert-butyl-1,2-oxazole-5-carboximidamide?
The InChIKey is YFJIYKJECMZVIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O/c1-8(2,3)6-4-5(7(9)10)12-11-6/h4H,1-3H3,(H3,9,10).
What are the key properties of 3-tert-butyl-1,2-oxazole-5-carboximidamide?
3-tert-butyl-1,2-oxazole-5-carboximidamide has a molecular weight of 167.21 g/mol, XLogP of 1.26, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-1,2-oxazole-5-carboximidamide is sourced from PubChem (CID 58057178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).