C23H26N2O5 — CID 58057241
(5S)-3-[(3R)-1-hydroxy-4-methyl-2-oxopentan-3-yl]-5-[2-(4-phenoxyphenyl)ethyl]imidazolidine-2,4-dione (PubChem CID 58057241) has the molecular formula C23H26N2O5 and a molecular weight of 410.47 g/mol. Its IUPAC name is (5S)-3-[(3R)-1-hydroxy-4-methyl-2-oxopentan-3-yl]-5-[2-(4-phenoxyphenyl)ethyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-3-[(3R)-1-hydroxy-4-methyl-2-oxopentan-3-yl]-5-[2-(4-phenoxyphenyl)ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 58057241 |
| Molecular Formula | C23H26N2O5 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | (5S)-3-[(3R)-1-hydroxy-4-methyl-2-oxopentan-3-yl]-5-[2-(4-phenoxyphenyl)ethyl]imidazolidine-2,4-dione |
| SMILES | CC(C)[C@H](C(=O)CO)N1C(=O)N[C@@H](CCc2ccc(Oc3ccccc3)cc2)C1=O |
| InChI | InChI=1S/C23H26N2O5/c1-15(2)21(20(27)14-26)25-22(28)19(24-23(25)29)13-10-16-8-11-18(12-9-16)30-17-6-4-3-5-7-17/h3-9,11-12,15,19,21,26H,10,13-14H2,1-2H3,(H,24,29)/t19-,21+/m0/s1 |
| InChIKey | HYCWHSOWDQEVNV-PZJWPPBQSA-N |
| XLogP | 2.92 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|